Quorumpeps Molecule

Quorumpeps®

Ac-CAFIM, thiolacton linkage between C1 and M5

Quorumpeps moleculeID1
SMILESO=C1SCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC1CCSC)C(C)CC)Cc2ccccc2)C)NC(=O)C
Molecular formulaC28H41N5O6S2
Chemical information
Species origin
Functionality
Literature