Quorumpeps Molecule

Quorumpeps®

ADLPFEF

Quorumpeps moleculeID10
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)O)Cc1ccccc1)CCC(=O)O)Cc2ccccc2)C3N(C(=O)C(NC(=O)C(NC(=O)C(N)C)CC(=O)O)CC(C)C)CCC3
Molecular formulaC41H55N7O12
Chemical information
Species origin
Functionality
Literature