Quorumpeps Molecule

Quorumpeps®

GNWNN

Quorumpeps moleculeID103
SMILESO=C(O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CN)CC(=O)N)Cc2c1ccccc1nc2)CC(=O)N)CC(=O)N
Molecular formulaC25H33N9O9
Chemical information
Species origin
Functionality
Literature