Quorumpeps Molecule

Quorumpeps®

GVAACSSLF, thiolacton linkage between C5 and F9

Quorumpeps moleculeID106
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)Cc2ccccc2)CC(C)C)CO)CO)C)C)C(C)C)CN
Molecular formulaC37H57N9O11S
Chemical information
Species origin
Functionality
Literature