Quorumpeps Molecule

Quorumpeps®

GVNACSSLF, thiolacton linkage between C5 and F9

Quorumpeps moleculeID107
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)Cc2ccccc2)CC(C)C)CO)CO)C)CC(=O)N)C(C)C)CN
Molecular formulaC38H58N10O12S
Chemical information
Quorumpeps moleculeID107
SequenceGVNACSSLF, thiolacton linkage between C5 and F9
Trivial namesAutoinducing peptide 2, AIP2
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)Cc2ccccc2)CC(C)C)CO)CO)C)CC(=O)N)C(C)C)CN
Molecular formulaC38H58N10O12S
Molecular weight879.1299999999999
LogP-4.83
Isoelectric point (pl)8.85
Species origin
Functionality
Literature