Quorumpeps Molecule

Quorumpeps®

GVNACSSLF, lactam linkage between C5 and F9

Quorumpeps moleculeID108
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)N1C(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C1CS)CO)CO)CC(C)C)Cc2ccccc2)C)CC(=O)N)C(C)C)CN
Molecular formulaC38H58N10O12S1
Chemical information
Species origin
Functionality
Literature