Quorumpeps Molecule

Quorumpeps®

GVNASSSLF, lacton linkage between S5 and F9

Quorumpeps moleculeID109
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)OC1)Cc2ccccc2)CC(C)C)CO)CO)C)CC(=O)N)C(C)C)CN
Molecular formulaC38H58N10O13
Chemical information
Species origin
Functionality
Literature