Quorumpeps Molecule

Quorumpeps®

GVNPCGGWF, thiolacton linkage between C5 and F9

Quorumpeps moleculeID110
SMILESO=C(NC(C(=O)NC(C(=O)N1CCCC1C(=O)NC2C(=O)NCC(=O)NCC(=O)NC(C(=O)NC(C(=O)SC2)Cc3ccccc3)Cc5c4ccccc4nc5)CC(=O)N)C(C)C)CN
Molecular formulaC43H55N11O10S
Chemical information
Species origin
Literature