Quorumpeps Molecule

Quorumpeps®

GKCVLVTL, thiolacton linkage between C3 and L8

Quorumpeps moleculeID111
SMILESO=C(NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)CC(C)C)C(O)C)C(C)C)CC(C)C)C(C)C)CCCCN)CN
Molecular formulaC37H67N9O9S1
Chemical information
Species origin
Functionality
Literature