Quorumpeps Molecule

Quorumpeps®

GYRTCNTYF, thiolacton linkage between C5 and F9

Quorumpeps moleculeID113
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)Cc2ccccc2)Cc3ccc(O)cc3)C(O)C)CC(=O)N)C(O)C)CCCNC(=[N@H])N)Cc4ccc(O)cc4)CN
Molecular formulaC50H67N13O14S
Chemical information
Species origin
Literature