Quorumpeps Molecule

Quorumpeps®

GYSTCSYYF, thiolacton linkage between C5 and F9

Quorumpeps moleculeID114
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)Cc2ccccc2)Cc3ccc(O)cc3)Cc4ccc(O)cc4)CO)C(O)C)CO)Cc5ccc(O)cc5)CN
Molecular formulaC51H61N9O15S
Chemical information
Species origin
Literature