Quorumpeps Molecule

Quorumpeps®

ASTCDFIM, thiolacton linkage between C4 and M8

Quorumpeps moleculeID115
SMILESO=C(NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)CCSC)C(C)CC)Cc2ccccc2)CC(=O)O)C(O)C)CO)C(N)C
Molecular formulaC37H56N8O12S2
Chemical information
Species origin
Functionality
Literature