Quorumpeps Molecule

Quorumpeps®

YATCDFIM, thiolacton linkage between C4 and M8

Quorumpeps moleculeID116
SMILESO=C(NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)CCSC)C(C)CC)Cc2ccccc2)CC(=O)O)C(O)C)C)C(N)Cc3ccc(O)cc3
Molecular formulaC43H60N8O12S2
Chemical information
Species origin
Functionality
Literature