Quorumpeps Molecule

Quorumpeps®

YSTCDAIM, thiolacton linkage between C4 and M8

Quorumpeps moleculeID118
SMILESO=C(NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)CCSC)C(C)CC)C)CC(=O)O)C(O)C)CO)C(N)Cc2ccc(O)cc2
Molecular formulaC37H56N8O13S2
Chemical information
Species origin
Functionality
Literature