Quorumpeps Molecule

Quorumpeps®

YSTCDFAM, thiolacton linkage between C4 and M8

Quorumpeps moleculeID119
SMILESO=C(NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)CCSC)C)Cc2ccccc2)CC(=O)O)C(O)C)CO)C(N)Cc3ccc(O)cc3
Molecular formulaC40H54N8O13S2
Chemical information
Species origin
Functionality
Literature