Quorumpeps Molecule

Quorumpeps®

YSTCSSLF, thiolacton linkage between C4 and F8

Quorumpeps moleculeID120
SMILESO=C(NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)Cc2ccccc2)CC(C)C)CO)CO)C(O)C)CO)C(N)Cc3ccc(O)cc3
Molecular formulaC40H56N8O13S
Chemical information
Species origin
Functionality
Literature