Quorumpeps Molecule

Quorumpeps®

ILSGAPCIPW

Quorumpeps moleculeID121
SMILESO=C(NC(C(=O)O)Cc2c1ccccc1nc2)C4N(C(=O)C(NC(=O)C(NC(=O)C3N(C(=O)C(NC(=O)CNC(=O)C(NC(=O)C(NC(=O)C(N)C(C)CC)CC(C)C)CO)C)CCC3)CS)C(C)CC)CCC4
Molecular formulaC50H77N11O12S
Chemical information
Species origin
Functionality
Literature