Quorumpeps Molecule

Quorumpeps®

INCDFLL, thiolacton linkage between C3 and L7

Quorumpeps moleculeID122
SMILESO=C(N)CC(NC(=O)C(N)C(C)CC)C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)CC(C)C)CC(C)C)Cc2ccccc2)CC(=O)O
Molecular formulaC38H58N8O10S
Chemical information
Quorumpeps moleculeID122
SequenceINCDFLL, thiolacton linkage between C3 and L7
Trivial namesAutoinducing peptide 3, AIP3
SMILESO=C(N)CC(NC(=O)C(N)C(C)CC)C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)CC(C)C)CC(C)C)Cc2ccccc2)CC(=O)O
Molecular formulaC38H58N8O10S
Molecular weight819.11
LogP-0.67
Isoelectric point (pl)6
Species origin
Functionality
Literature