Quorumpeps Molecule

Quorumpeps®

IRFVT

Quorumpeps moleculeID123
SMILESO=C(O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)C(C)CC)CCCNC(=[N@H])N)Cc1ccccc1)C(C)C)C(O)C
Molecular formulaC30H50N8O7
Chemical information
Species origin
Functionality
Literature