Quorumpeps Molecule

Quorumpeps®

KAKTCTVLY, thiolacton linkage between C5 and Y9

Quorumpeps moleculeID124
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)Cc2ccc(O)cc2)CC(C)C)C(C)C)C(O)C)C(O)C)CCCCN)C)C(N)CCCCN
Molecular formulaC46H77N11O12S
Chemical information
Species origin
Literature