Quorumpeps Molecule

Quorumpeps®

KTKTCTVLY, thiolacton linkage between C5 and Y9

Quorumpeps moleculeID126
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)Cc2ccc(O)cc2)CC(C)C)C(C)C)C(O)C)C(O)C)CCCCN)C(O)C)C(N)CCCCN
Molecular formulaC47H79N11O13S
Chemical information
Species origin
Literature