Quorumpeps Molecule

Quorumpeps®

KYNPCASYL, thiolacton linkage between C5 and L9

Quorumpeps moleculeID128
SMILESO=C(NC(C(=O)NC(C(=O)N1CCCC1C(=O)NC2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC2)CC(C)C)Cc3ccc(O)cc3)CO)C)CC(=O)N)Cc4ccc(O)cc4)C(N)CCCCN
Molecular formulaC48H69N11O13S
Chemical information
Species origin
Literature