Quorumpeps Molecule

Quorumpeps®

AIFILAS

Quorumpeps moleculeID13
SMILESO=C(O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)C)C(C)CC)Cc1ccccc1)C(C)CC)CC(C)C)C)CO
Molecular formulaC36H59N7O9
Chemical information
Species origin
Functionality
Literature