Quorumpeps Molecule

Quorumpeps®

KYNPCSNYL, thiolacton linkage between C5 and L9

Quorumpeps moleculeID130
SMILESO=C(NC(C(=O)NC(C(=O)N1CCCC1C(=O)NC2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC2)CC(C)C)Cc3ccc(O)cc3)CC(=O)N)CO)CC(=O)N)Cc4ccc(O)cc4)C(N)CCCCN
Molecular formulaC49H70N12O14S
Chemical information
Species origin
Functionality
Literature