Quorumpeps Molecule

Quorumpeps®

KYYPCFGYF, thiolacton linkage between C5 and F9

Quorumpeps moleculeID131
SMILESO=C(NC(C(=O)NC(C(=O)N1CCCC1C(=O)NC2C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)SC2)Cc3ccccc3)Cc4ccc(O)cc4)Cc5ccccc5)Cc6ccc(O)cc6)Cc7ccc(O)cc7)C(N)CCCCN
Molecular formulaC61H72N10O12S
Chemical information
Species origin
Literature