Quorumpeps Molecule

Quorumpeps®

LFSLVLAG

Quorumpeps moleculeID132
SMILESO=C(O)CNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CC(C)C)Cc1ccccc1)CO)CC(C)C)C(C)C)CC(C)C)C
Molecular formulaC40H66N8O10
Chemical information
Species origin
Functionality
Literature