Quorumpeps Molecule

Quorumpeps®

LFVVTLVG

Quorumpeps moleculeID133
SMILESO=C(O)CNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CC(C)C)Cc1ccccc1)C(C)C)C(C)C)C(O)C)CC(C)C)C(C)C
Molecular formulaC42H70N8O10
Chemical information
Species origin
Functionality
Literature