Quorumpeps Molecule

Quorumpeps®

LPFEF

Quorumpeps moleculeID134
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)O)Cc1ccccc1)CCC(=O)O)Cc2ccccc2)C3N(C(=O)C(N)CC(C)C)CCC3
Molecular formulaC34H45N5O8
Chemical information
Species origin
Functionality
Literature