Quorumpeps Molecule

Quorumpeps®

LPFEH

Quorumpeps moleculeID135
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)O)Cc1cncn1)CCC(=O)O)Cc2ccccc2)C3N(C(=O)C(N)CC(C)C)CCC3
Molecular formulaC31H43N7O8
Chemical information
Species origin
Functionality
Literature