Quorumpeps Molecule

Quorumpeps®

LVTLVFV

Quorumpeps moleculeID137
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)O)C(C)C)Cc1ccccc1)C(C)C)CC(C)C)C(O)C)C(C)C)C(N)CC(C)C
Molecular formulaC40H67N7O9
Chemical information
Species origin
Functionality
Literature