Quorumpeps Molecule

Quorumpeps®

NGKCVLVTL, thiolacton linkage between C4 and L9

Quorumpeps moleculeID139
SMILESO=C(N)CC(N)C(=O)NCC(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)CC(C)C)C(O)C)C(C)C)CC(C)C)C(C)C)CCCCN
Molecular formulaC41H73N11O11S1
Chemical information
Species origin
Functionality
Literature