Quorumpeps Molecule

Quorumpeps®

AITLIFI

Quorumpeps moleculeID14
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)O)C(C)CC)Cc1ccccc1)C(C)CC)CC(C)C)C(O)C)C(C)CC)C(N)C
Molecular formulaC40H67N7O9
Chemical information
Species origin
Functionality
Literature