Quorumpeps Molecule

Quorumpeps®

MKAEH

Quorumpeps moleculeID140
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)O)Cc1cncn1)CCC(=O)O)C)CCCCN)C(N)CCSC
Molecular formulaC25H42N8O8S
Chemical information
Species origin
Functionality
Literature