Quorumpeps Molecule

Quorumpeps®

MLDW(Geranyl)KY

Quorumpeps moleculeID141
SMILESO=C(O)C(NC(=O)C(NC(=O)C2N(C(=O)C(NC(=O)C(NC(=O)C(N)CCSC)CC(C)C)CC(=O)O)C3Nc1ccccc1C3(C2)C\C=C(/C)CC\C=C(/C)C)CCCCN)Cc4ccc(O)cc4
Molecular formulaC51H74N8O10S
Chemical information
Species origin
Functionality
Literature