Quorumpeps Molecule

Quorumpeps®

MMDW(Geranyl)HY

Quorumpeps moleculeID142
SMILESO=C(O)C(NC(=O)C(NC(=O)C2N(C(=O)C(NC(=O)C(NC(=O)C(N)CCSC)CCSC)CC(=O)O)C3Nc1ccccc1C3(C2)C\C=C(/C)CC\C=C(/C)C)Cc4cncn4)Cc5ccc(O)cc5
Molecular formulaC50H67N9O10S2
Chemical information
Species origin
Functionality
Literature