Quorumpeps Molecule

Quorumpeps®

Ac-CDFIM, thiolacton linkage between C1 and M5

Quorumpeps moleculeID145
SMILESO=C(O)CC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SCC(C(=O)N1)NC(=O)C)CCSC)C(C)CC)Cc2ccccc2
Molecular formulaC29H41N5O8S2
Chemical information
Species origin
Functionality
Literature