Quorumpeps Molecule

Quorumpeps®

NEVPFEF

Quorumpeps moleculeID146
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)O)Cc1ccccc1)CCC(=O)O)Cc2ccccc2)C3N(C(=O)C(NC(=O)C(NC(=O)C(N)CC(=O)N)CCC(=O)O)C(C)C)CCC3
Molecular formulaC42H56N8O13
Chemical information
Species origin
Functionality
Literature