Quorumpeps Molecule

Quorumpeps®

YSTCYFIM, thiolacton linkage between C4 and M8

Quorumpeps moleculeID149
SMILESO=C(NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)CCSC)C(C)CC)Cc2ccccc2)Cc3ccc(O)cc3)C(O)C)CO)C(N)Cc4ccc(O)cc4
Molecular formulaC48H64N8O12S2
Chemical information
Species origin
Functionality
Literature