Quorumpeps Molecule

Quorumpeps®

AKDEH

Quorumpeps moleculeID15
SMILESO=C(O)CC(NC(=O)C(NC(=O)C(N)C)CCCCN)C(=O)NC(C(=O)NC(C(=O)O)Cc1cncn1)CCC(=O)O
Molecular formulaC24H38N8O10
Chemical information
Species origin
Functionality
Literature