Quorumpeps Molecule

Quorumpeps®

NNGNN

Quorumpeps moleculeID151
SMILESO=C(NC(C(=O)O)CC(=O)N)C(NC(=O)CNC(=O)C(NC(=O)C(N)CC(=O)N)CC(=O)N)CC(=O)N
Molecular formulaC18H29N9O10
Chemical information
Species origin
Functionality
Literature