Quorumpeps Molecule

Quorumpeps®

NNNWNNN

Quorumpeps moleculeID152
SMILESO=C(O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CC(=O)N)CC(=O)N)CC(=O)N)Cc2c1ccccc1nc2)CC(=O)N)CC(=O)N)CC(=O)N
Molecular formulaC35H48N14O14
Chemical information
Species origin
Functionality
Literature