Quorumpeps Molecule

Quorumpeps®

NWN

Quorumpeps moleculeID155
SMILESO=C(O)C(NC(=O)C(NC(=O)C(N)CC(=O)N)Cc2c1ccccc1nc2)CC(=O)N
Molecular formulaC19H24N6O6
Chemical information
Species origin
Functionality
Literature