Quorumpeps Molecule

Quorumpeps®

PITNF-NH2

Quorumpeps moleculeID156
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N)Cc1ccccc1)CC(=O)N)C(O)C)C(C)CC)C2NCCC2
Molecular formulaC28H43N7O7
Chemical information
Species origin
Functionality
Literature