Quorumpeps Molecule

Quorumpeps®

PWTNF-NH2

Quorumpeps moleculeID157
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N)Cc1ccccc1)CC(=O)N)C(O)C)Cc3c2ccccc2nc3)C4NCCC4
Molecular formulaC33H42N8O7
Chemical information
Species origin
Functionality
Literature