Quorumpeps Molecule

Quorumpeps®

AKTVQ

Quorumpeps moleculeID16
SMILESO=C(NC(C(=O)NC(C(=O)O)CCC(=O)N)C(C)C)C(NC(=O)C(NC(=O)C(N)C)CCCCN)C(O)C
Molecular formulaC23H43N7O8
Chemical information
Species origin
Functionality
Literature