Quorumpeps Molecule

Quorumpeps®

QKGMY

Quorumpeps moleculeID160
SMILESO=C(N)CCC(N)C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)O)Cc1ccc(O)cc1)CCSC)CCCCN
Molecular formulaC27H43N7O8S
Chemical information
Species origin
Functionality
Literature