Quorumpeps Molecule

Quorumpeps®

QRGMI

Quorumpeps moleculeID162
SMILESO=C(NC(C(=O)NC(C(=O)O)C(C)CC)CCSC)CNC(=O)C(NC(=O)C(N)CCC(=O)N)CCCNC(=[N@H])N
Molecular formulaC24H45N9O7S
Chemical information
Species origin
Functionality
Literature