Quorumpeps Molecule

Quorumpeps®

RIPTSTGFF, lacton linkage between S5 and F9

Quorumpeps moleculeID163
SMILESO=C(NC(C(=O)N1CCCC1C(=O)NC(C(=O)NC2C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)OC2)Cc3ccccc3)Cc4ccccc4)C(O)C)C(O)C)C(C)CC)C(N)CCCNC(=[N@H])N
Molecular formulaC48H70N12O12
Chemical information
Species origin
Functionality
Literature