Quorumpeps Molecule

Quorumpeps®

SDLPFEH

Quorumpeps moleculeID164
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)O)Cc1cncn1)CCC(=O)O)Cc2ccccc2)C3N(C(=O)C(NC(=O)C(NC(=O)C(N)CO)CC(=O)O)CC(C)C)CCC3
Molecular formulaC38H53N9O13
Chemical information
Species origin
Functionality
Literature