Quorumpeps Molecule

Quorumpeps®

SDMPFEF

Quorumpeps moleculeID165
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)O)Cc1ccccc1)CCC(=O)O)Cc2ccccc2)C3N(C(=O)C(NC(=O)C(NC(=O)C(N)CO)CC(=O)O)CCSC)CCC3
Molecular formulaC40H53N7O13S1
Chemical information
Species origin
Functionality
Literature